About 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane
2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane (PubChem CID 58555851) has the molecular formula C21H23F3O
and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane.
Molecular Properties
| Compound Name | 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane |
| PubChem CID | 58555851 |
| Molecular Formula | C21H23F3O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane |
| SMILES | CCCC1CCC(CCc2ccc(-c3cc(F)c(F)c(F)c3)cc2)O1 |
| InChI | InChI=1S/C21H23F3O/c1-2-3-17-10-11-18(25-17)9-6-14-4-7-15(8-5-14)16-12-19(22)21(24)20(23)13-16/h4-5,7-8,12-13,17-18H,2-3,6,9-11H2,1H3 |
| InChIKey | FXEMHPNOAIYHOJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane?
The IUPAC name of 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane (CID 58555851) is 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane.
What is the SMILES notation for 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane?
The canonical SMILES for 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane is CCCC1CCC(CCc2ccc(-c3cc(F)c(F)c(F)c3)cc2)O1.
What is the InChIKey of 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane?
The InChIKey is FXEMHPNOAIYHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F3O/c1-2-3-17-10-11-18(25-17)9-6-14-4-7-15(8-5-14)16-12-19(22)21(24)20(23)13-16/h4-5,7-8,12-13,17-18H,2-3,6,9-11H2,1H3.
What are the key properties of 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane?
2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane has a molecular weight of 348.41 g/mol, XLogP of 6.05, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]oxolane is sourced from PubChem (CID 58555851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).