About 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole
4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole (PubChem CID 58555962) has the molecular formula C6H2F2N2O2
and a molecular weight of 172.09 g/mol. Its IUPAC name is 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole |
| PubChem CID | 58555962 |
| Molecular Formula | C6H2F2N2O2 |
| Molecular Weight | 172.09 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole |
| SMILES | Fc1coc(-c2nc(F)co2)n1 |
| InChI | InChI=1S/C6H2F2N2O2/c7-3-1-11-5(9-3)6-10-4(8)2-12-6/h1-2H |
| InChIKey | LAWYLWIWSBSKJK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole?
The IUPAC name of 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole (CID 58555962) is 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole.
What is the SMILES notation for 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole?
The canonical SMILES for 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole is Fc1coc(-c2nc(F)co2)n1.
What is the InChIKey of 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole?
The InChIKey is LAWYLWIWSBSKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F2N2O2/c7-3-1-11-5(9-3)6-10-4(8)2-12-6/h1-2H.
What are the key properties of 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole?
4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole has a molecular weight of 172.09 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-(4-fluoro-1,3-oxazol-2-yl)-1,3-oxazole is sourced from PubChem (CID 58555962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).