About iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide
iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide (PubChem CID 58556408) has the molecular formula C14H14IrN4-2
and a molecular weight of 430.51 g/mol. Its IUPAC name is iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide.
Molecular Properties
| Compound Name | iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide |
| PubChem CID | 58556408 |
| Molecular Formula | C14H14IrN4-2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide |
| SMILES | CC(C)N1[CH-]N(c2[c-]cccc2)c2nccnc21.[Ir] |
| InChI | InChI=1S/C14H14N4.Ir/c1-11(2)17-10-18(12-6-4-3-5-7-12)14-13(17)15-8-9-16-14;/h3-6,8-11H,1-2H3;/q-2; |
| InChIKey | PCFRAAXBAUGJLO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide?
The IUPAC name of iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide (CID 58556408) is iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide.
What is the SMILES notation for iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide?
The canonical SMILES for iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide is CC(C)N1[CH-]N(c2[c-]cccc2)c2nccnc21.[Ir].
What is the InChIKey of iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide?
The InChIKey is PCFRAAXBAUGJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4.Ir/c1-11(2)17-10-18(12-6-4-3-5-7-12)14-13(17)15-8-9-16-14;/h3-6,8-11H,1-2H3;/q-2;.
What are the key properties of iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide?
iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide has a molecular weight of 430.51 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyl-3-propan-2-yl-2H-imidazo[4,5-b]pyrazin-2-ide is sourced from PubChem (CID 58556408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).