C93H84N6 — CID 58556543
3,6-bis[3,6-bis(4-tert-butylphenyl)carbazol-9-yl]-9-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 58556543) has the molecular formula C93H84N6 and a molecular weight of 1285.74 g/mol. Its IUPAC name is 3,6-bis[3,6-bis(4-tert-butylphenyl)carbazol-9-yl]-9-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 3,6-bis[3,6-bis(4-tert-butylphenyl)carbazol-9-yl]-9-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 58556543 |
| Molecular Formula | C93H84N6 |
| Molecular Weight | 1285.74 g/mol |
| Exact Mass | 1284.68 |
| IUPAC Name | 3,6-bis[3,6-bis(4-tert-butylphenyl)carbazol-9-yl]-9-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | Cc1cccc(-c2nc(-c3cccc(C)c3)nc(-n3c4ccc(-n5c6ccc(-c7ccc(C(C)(C)C)cc7)cc6c6cc(-c7ccc(C(C)(C)C)cc7)ccc65)cc4c4cc(-n5c6ccc(-c7ccc(C(C)(C)C)cc7)cc6c6cc(-c7ccc(C(C)(C)C)cc7)ccc65)ccc43)n2)c1 |
| InChI | InChI=1S/C93H84N6/c1-57-17-15-19-67(49-57)87-94-88(68-20-16-18-58(2)50-68)96-89(95-87)99-85-47-41-73(97-81-43-29-63(59-21-33-69(34-22-59)90(3,4)5)51-75(81)76-52-64(30-44-82(76)97)60-23-35-70(36-24-60)91(6,7)8)55-79(85)80-56-74(42-48-86(80)99)98-83-45-31-65(61-25-37-71(38-26-61)92(9,10)11)53-77(83)78-54-66(32-46-84(78)98)62-27-39-72(40-28-62)93(12,13)14/h15-56H,1-14H3 |
| InChIKey | FQXLMKUUYFELNM-UHFFFAOYSA-N |
| XLogP | 24.97 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1285.74 |
| LogP ≤ 5 | 24.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |