C18H17N7S — CID 58557153
2-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-1,3-thiazole-5-carbonitrile (PubChem CID 58557153) has the molecular formula C18H17N7S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 58557153 |
| Molecular Formula | C18H17N7S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-1,3-thiazole-5-carbonitrile |
| SMILES | C[C@H]1CCN(c2ncc(C#N)s2)C[C@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H17N7S/c1-11-3-5-24(18-23-9-13(6-19)26-18)10-14(11)17-22-8-12-7-21-16-15(25(12)17)2-4-20-16/h2,4,7-9,11,14,20H,3,5,10H2,1H3/t11-,14+/m0/s1 |
| InChIKey | ICUFXRJFOZMTJS-SMDDNHRTSA-N |
| XLogP | 3.17 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |