C14H18N6 — CID 58557188
(3S,5R)-5-ethyl-1-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)pyrrolidin-3-amine (PubChem CID 58557188) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is (3S,5R)-5-ethyl-1-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)pyrrolidin-3-amine.
| Compound Name | (3S,5R)-5-ethyl-1-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 58557188 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (3S,5R)-5-ethyl-1-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)pyrrolidin-3-amine |
| SMILES | CC[C@@H]1C[C@H](N)CN1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H18N6/c1-2-10-5-9(15)8-19(10)13-7-17-12-6-18-14-11(20(12)13)3-4-16-14/h3-4,6-7,9-10,16H,2,5,8,15H2,1H3/t9-,10+/m0/s1 |
| InChIKey | WYUCSPJESWVNRU-VHSXEESVSA-N |
| XLogP | 1.53 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |