C17H20F2N6O2S — CID 58557413
3,3-difluoro-N-[(1S,3R,4S)-3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]azetidine-1-sulfonamide (PubChem CID 58557413) has the molecular formula C17H20F2N6O2S and a molecular weight of 410.45 g/mol. Its IUPAC name is 3,3-difluoro-N-[(1S,3R,4S)-3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]azetidine-1-sulfonamide.
| Compound Name | 3,3-difluoro-N-[(1S,3R,4S)-3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]azetidine-1-sulfonamide |
|---|---|
| PubChem CID | 58557413 |
| Molecular Formula | C17H20F2N6O2S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3,3-difluoro-N-[(1S,3R,4S)-3-methyl-4-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]azetidine-1-sulfonamide |
| SMILES | C[C@@H]1C[C@H](NS(=O)(=O)N2CC(F)(F)C2)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C17H20F2N6O2S/c1-10-4-11(23-28(26,27)24-8-17(18,19)9-24)5-13(10)16-22-7-12-6-21-15-14(25(12)16)2-3-20-15/h2-3,6-7,10-11,13,20,23H,4-5,8-9H2,1H3/t10-,11+,13+/m1/s1 |
| InChIKey | SZRXFJSYMHOOIY-MDZLAQPJSA-N |
| XLogP | 1.88 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |