C25H32N8O2Si — CID 58557416
5-[3-ethyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]oxypyrazine-2-carbonitrile (PubChem CID 58557416) has the molecular formula C25H32N8O2Si and a molecular weight of 504.67 g/mol. Its IUPAC name is 5-[3-ethyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]oxypyrazine-2-carbonitrile.
| Compound Name | 5-[3-ethyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]oxypyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 58557416 |
| Molecular Formula | C25H32N8O2Si |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 5-[3-ethyl-4-[5-(2-trimethylsilylethoxymethyl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]oxypyrazine-2-carbonitrile |
| SMILES | CCC1CC(Oc2cnc(C#N)cn2)CC1c1nnc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C25H32N8O2Si/c1-5-17-10-19(35-23-15-27-18(12-26)13-28-23)11-20(17)24-31-30-22-14-29-25-21(33(22)24)6-7-32(25)16-34-8-9-36(2,3)4/h6-7,13-15,17,19-20H,5,8-11,16H2,1-4H3 |
| InChIKey | BQROZMYARCAZCB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 116.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|