C18H22F2N6O2S — CID 58557424
N-[(1S,3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide (PubChem CID 58557424) has the molecular formula C18H22F2N6O2S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[(1S,3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide.
| Compound Name | N-[(1S,3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide |
|---|---|
| PubChem CID | 58557424 |
| Molecular Formula | C18H22F2N6O2S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(1S,3R,4S)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide |
| SMILES | CC[C@@H]1C[C@H](NS(=O)(=O)N2CC(F)(F)C2)C[C@@H]1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H22F2N6O2S/c1-2-11-5-12(24-29(27,28)25-9-18(19,20)10-25)6-13(11)15-7-22-16-8-23-17-14(26(15)16)3-4-21-17/h3-4,7-8,11-13,21,24H,2,5-6,9-10H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | VXPRXYSAIDDHEA-AGIUHOORSA-N |
| XLogP | 2.27 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |