C12H20O4 — CID 58557462
ethyl 7-ethyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate (PubChem CID 58557462) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 7-ethyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate.
| Compound Name | ethyl 7-ethyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 58557462 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl 7-ethyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate |
| SMILES | CCOC(=O)C1CC2(CC1CC)OCCO2 |
| InChI | InChI=1S/C12H20O4/c1-3-9-7-12(15-5-6-16-12)8-10(9)11(13)14-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | GIVQATSFIGOPCY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |