C23H23N9O2S — CID 58557482
5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58557482) has the molecular formula C23H23N9O2S and a molecular weight of 489.57 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58557482 |
| Molecular Formula | C23H23N9O2S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccnc(N4CCN(C)CC4)n3)c3c2ncc2nncn23)cc1 |
| InChI | InChI=1S/C23H23N9O2S/c1-16-3-5-17(6-4-16)35(33,34)32-14-18(21-22(32)25-13-20-28-26-15-31(20)21)19-7-8-24-23(27-19)30-11-9-29(2)10-12-30/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | WYQBTEWHMSTGFX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |