C22H32F3N5OSSi — CID 58557493
2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfanyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58557493) has the molecular formula C22H32F3N5OSSi and a molecular weight of 499.68 g/mol. Its IUPAC name is 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfanyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfanyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58557493 |
| Molecular Formula | C22H32F3N5OSSi |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfanyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1CC(SCC(F)(F)F)CC1c1nnc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C22H32F3N5OSSi/c1-5-15-10-16(32-13-22(23,24)25)11-17(15)20-28-27-19-12-26-21-18(30(19)20)6-7-29(21)14-31-8-9-33(2,3)4/h6-7,12,15-17H,5,8-11,13-14H2,1-4H3 |
| InChIKey | FVPLFURUDFDYQA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|