C14H17N5 — CID 58557534
cis-(1S,3R)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine (PubChem CID 58557534) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is cis-(1S,3R)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 58557534 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | cis-(1S,3R)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine |
| SMILES | C[C@@H]1C[C@H](N)CC1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H17N5/c1-8-4-9(15)5-10(8)12-6-17-13-7-18-14-11(19(12)13)2-3-16-14/h2-3,6-10,16H,4-5,15H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | KPYMPRAAVFVPGM-ZDGBYWQASA-N |
| XLogP | 2.05 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |