C15H19N5 — CID 58557594
[4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclohexyl]methanamine (PubChem CID 58557594) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is [4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclohexyl]methanamine.
| Compound Name | [4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 58557594 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclohexyl]methanamine |
| SMILES | NCC1CCC(c2cnc3cnc4[nH]ccc4n23)CC1 |
| InChI | InChI=1S/C15H19N5/c16-7-10-1-3-11(4-2-10)13-8-18-14-9-19-15-12(20(13)14)5-6-17-15/h5-6,8-11,17H,1-4,7,16H2 |
| InChIKey | HMEFFIQBDXDHGO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |