C23H22N6O2S — CID 58557620
5-(4-methylphenyl)sulfonyl-12-[(3S)-3-pyrrol-1-ylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58557620) has the molecular formula C23H22N6O2S and a molecular weight of 446.54 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-12-[(3S)-3-pyrrol-1-ylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-(4-methylphenyl)sulfonyl-12-[(3S)-3-pyrrol-1-ylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58557620 |
| Molecular Formula | C23H22N6O2S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-12-[(3S)-3-pyrrol-1-ylcyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2nnc(C4CC[C@H](n5cccc5)C4)n23)cc1 |
| InChI | InChI=1S/C23H22N6O2S/c1-16-4-8-19(9-5-16)32(30,31)28-13-10-20-23(28)24-15-21-25-26-22(29(20)21)17-6-7-18(14-17)27-11-2-3-12-27/h2-5,8-13,15,17-18H,6-7,14H2,1H3/t17?,18-/m0/s1 |
| InChIKey | CBAFLNOIAKHAGU-ZVAWYAOSSA-N |
| XLogP | 3.93 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |