About 1-ethenylsulfonyl-3,3-difluoropyrrolidine
1-ethenylsulfonyl-3,3-difluoropyrrolidine (PubChem CID 58557782) has the molecular formula C6H9F2NO2S
and a molecular weight of 197.21 g/mol. Its IUPAC name is 1-ethenylsulfonyl-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-ethenylsulfonyl-3,3-difluoropyrrolidine |
| PubChem CID | 58557782 |
| Molecular Formula | C6H9F2NO2S |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 1-ethenylsulfonyl-3,3-difluoropyrrolidine |
| SMILES | C=CS(=O)(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C6H9F2NO2S/c1-2-12(10,11)9-4-3-6(7,8)5-9/h2H,1,3-5H2 |
| InChIKey | FUPYSFKDOCPEAU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenylsulfonyl-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylsulfonyl-3,3-difluoropyrrolidine?
The IUPAC name of 1-ethenylsulfonyl-3,3-difluoropyrrolidine (CID 58557782) is 1-ethenylsulfonyl-3,3-difluoropyrrolidine.
What is the SMILES notation for 1-ethenylsulfonyl-3,3-difluoropyrrolidine?
The canonical SMILES for 1-ethenylsulfonyl-3,3-difluoropyrrolidine is C=CS(=O)(=O)N1CCC(F)(F)C1.
What is the InChIKey of 1-ethenylsulfonyl-3,3-difluoropyrrolidine?
The InChIKey is FUPYSFKDOCPEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO2S/c1-2-12(10,11)9-4-3-6(7,8)5-9/h2H,1,3-5H2.
What are the key properties of 1-ethenylsulfonyl-3,3-difluoropyrrolidine?
1-ethenylsulfonyl-3,3-difluoropyrrolidine has a molecular weight of 197.21 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylsulfonyl-3,3-difluoropyrrolidine is sourced from PubChem (CID 58557782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).