About N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide
N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide (PubChem CID 58557869) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide |
| PubChem CID | 58557869 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide |
| SMILES | CC[C@@H]1C[C@H](NS(=O)(=O)C2CC2)CN1 |
| InChI | InChI=1S/C9H18N2O2S/c1-2-7-5-8(6-10-7)11-14(12,13)9-3-4-9/h7-11H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | OBTIZFRBWFUEAF-SFYZADRCSA-N |
| XLogP | 0.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide?
The IUPAC name of N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide (CID 58557869) is N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide is CC[C@@H]1C[C@H](NS(=O)(=O)C2CC2)CN1.
What is the InChIKey of N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide?
The InChIKey is OBTIZFRBWFUEAF-SFYZADRCSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-2-7-5-8(6-10-7)11-14(12,13)9-3-4-9/h7-11H,2-6H2,1H3/t7-,8+/m1/s1.
What are the key properties of N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide?
N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide has a molecular weight of 218.32 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,5R)-5-ethylpyrrolidin-3-yl]cyclopropanesulfonamide is sourced from PubChem (CID 58557869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).