About 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate
3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate (PubChem CID 58557941) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate |
| PubChem CID | 58557941 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate |
| SMILES | CCC1CC(C(=O)OC)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24O4/c1-6-9-7-10(12(15)17-5)8-11(9)13(16)18-14(2,3)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | KORIVXAQYSVDHX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate (CID 58557941) is 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate is CCC1CC(C(=O)OC)CC1C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate?
The InChIKey is KORIVXAQYSVDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-6-9-7-10(12(15)17-5)8-11(9)13(16)18-14(2,3)4/h9-11H,6-8H2,1-5H3.
What are the key properties of 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate?
3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate has a molecular weight of 256.34 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl 4-ethylcyclopentane-1,3-dicarboxylate is sourced from PubChem (CID 58557941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).