C21H25F2N5O — CID 58557976
(4,4-difluorocyclohexyl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone (PubChem CID 58557976) has the molecular formula C21H25F2N5O and a molecular weight of 401.46 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone.
| Compound Name | (4,4-difluorocyclohexyl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58557976 |
| Molecular Formula | C21H25F2N5O |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (4,4-difluorocyclohexyl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCN(C(=O)C2CCC(F)(F)CC2)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C21H25F2N5O/c1-13-5-9-27(20(29)14-2-6-21(22,23)7-3-14)12-16(13)19-26-11-15-10-25-18-17(28(15)19)4-8-24-18/h4,8,10-11,13-14,16,24H,2-3,5-7,9,12H2,1H3/t13-,16+/m1/s1 |
| InChIKey | IWVVCEDEHAGFLU-CJNGLKHVSA-N |
| XLogP | 3.99 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |