C14H16N8 — CID 58558006
12-[(2R,4S)-4-azido-2-ethylpyrrolidin-1-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58558006) has the molecular formula C14H16N8 and a molecular weight of 296.34 g/mol. Its IUPAC name is 12-[(2R,4S)-4-azido-2-ethylpyrrolidin-1-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(2R,4S)-4-azido-2-ethylpyrrolidin-1-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58558006 |
| Molecular Formula | C14H16N8 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 12-[(2R,4S)-4-azido-2-ethylpyrrolidin-1-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CC[C@@H]1C[C@H](N=[N+]=[N-])CN1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H16N8/c1-2-10-5-9(19-20-15)8-21(10)13-7-17-12-6-18-14-11(22(12)13)3-4-16-14/h3-4,6-7,9-10,16H,2,5,8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | GWORZQRQPKVPIQ-VHSXEESVSA-N |
| XLogP | 2.88 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|