About ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium
ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium (PubChem CID 58558014) has the molecular formula C10H11N3O3SY-2
and a molecular weight of 342.19 g/mol. Its IUPAC name is ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium.
Molecular Properties
| Compound Name | ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium |
| PubChem CID | 58558014 |
| Molecular Formula | C10H11N3O3SY-2 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium |
| SMILES | C[C-]=O.[CH2-]c1cnc2c(ccn2S(C)(=O)=O)n1.[Y] |
| InChI | InChI=1S/C8H8N3O2S.C2H3O.Y/c1-6-5-9-8-7(10-6)3-4-11(8)14(2,12)13;1-2-3;/h3-5H,1H2,2H3;1H3;/q2*-1; |
| InChIKey | DPVAHMZMURHALX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium?
The IUPAC name of ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium (CID 58558014) is ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium.
What is the SMILES notation for ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium?
The canonical SMILES for ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium is C[C-]=O.[CH2-]c1cnc2c(ccn2S(C)(=O)=O)n1.[Y].
What is the InChIKey of ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium?
The InChIKey is DPVAHMZMURHALX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N3O2S.C2H3O.Y/c1-6-5-9-8-7(10-6)3-4-11(8)14(2,12)13;1-2-3;/h3-5H,1H2,2H3;1H3;/q2*-1;.
What are the key properties of ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium?
ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium has a molecular weight of 342.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanone;2-methanidyl-5-methylsulfonylpyrrolo[2,3-b]pyrazine;yttrium is sourced from PubChem (CID 58558014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).