C22H32F3N5O3SSi — CID 58558103
2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfonyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58558103) has the molecular formula C22H32F3N5O3SSi and a molecular weight of 531.68 g/mol. Its IUPAC name is 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfonyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfonyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58558103 |
| Molecular Formula | C22H32F3N5O3SSi |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-[[12-[2-ethyl-4-(2,2,2-trifluoroethylsulfonyl)cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1CC(S(=O)(=O)CC(F)(F)F)CC1c1nnc2cnc3c(ccn3COCC[Si](C)(C)C)n12 |
| InChI | InChI=1S/C22H32F3N5O3SSi/c1-5-15-10-16(34(31,32)13-22(23,24)25)11-17(15)20-28-27-19-12-26-21-18(30(19)20)6-7-29(21)14-33-8-9-35(2,3)4/h6-7,12,15-17H,5,8-11,13-14H2,1-4H3 |
| InChIKey | IAYRXSSIZPIEKE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|