C18H20F3N5O — CID 58558106
4,4,4-trifluoro-1-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]butan-1-one (PubChem CID 58558106) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58558106 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4,4,4-trifluoro-1-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]butan-1-one |
| SMILES | C[C@@H]1CCN(C(=O)CCC(F)(F)F)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H20F3N5O/c1-11-4-7-25(15(27)2-5-18(19,20)21)10-13(11)17-24-9-12-8-23-16-14(26(12)17)3-6-22-16/h3,6,8-9,11,13,22H,2,4-5,7,10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | WYUYZBIYZXOLPG-YPMHNXCESA-N |
| XLogP | 3.51 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |