C35H55N3O5 — CID 585582
methyl 2-[2,6-bis(adamantane-1-carbonylamino)hexanoylamino]-4-methylpentanoate (PubChem CID 585582) has the molecular formula C35H55N3O5 and a molecular weight of 597.84 g/mol. Its IUPAC name is methyl 2-[2,6-bis(adamantane-1-carbonylamino)hexanoylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[2,6-bis(adamantane-1-carbonylamino)hexanoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 585582 |
| Molecular Formula | C35H55N3O5 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.41 |
| IUPAC Name | methyl 2-[2,6-bis(adamantane-1-carbonylamino)hexanoylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C(CCCCNC(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H55N3O5/c1-21(2)8-29(31(40)43-3)37-30(39)28(38-33(42)35-18-25-12-26(19-35)14-27(13-25)20-35)6-4-5-7-36-32(41)34-15-22-9-23(16-34)11-24(10-22)17-34/h21-29H,4-20H2,1-3H3,(H,36,41)(H,37,39)(H,38,42) |
| InChIKey | CXHYTOMFTVQWPA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|