C33H39N3O7S — CID 58558880
(2S,4R)-N-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]-4-furo[2,3-f]isoquinolin-6-yloxy-1-[(2S)-2,3,3-trimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 58558880) has the molecular formula C33H39N3O7S and a molecular weight of 621.76 g/mol. Its IUPAC name is (2S,4R)-N-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]-4-furo[2,3-f]isoquinolin-6-yloxy-1-[(2S)-2,3,3-trimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]-4-furo[2,3-f]isoquinolin-6-yloxy-1-[(2S)-2,3,3-trimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58558880 |
| Molecular Formula | C33H39N3O7S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | (2S,4R)-N-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]-4-furo[2,3-f]isoquinolin-6-yloxy-1-[(2S)-2,3,3-trimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](Oc2nccc3c2ccc2ccoc23)CN1C(=O)[C@@H](C)C(C)(C)C)C(=O)CS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C33H39N3O7S/c1-6-21-16-33(21,27(37)18-44(40,41)23-8-9-23)35-29(38)26-15-22(17-36(26)31(39)19(2)32(3,4)5)43-30-25-10-7-20-12-14-42-28(20)24(25)11-13-34-30/h6-7,10-14,19,21-23,26H,1,8-9,15-18H2,2-5H3,(H,35,38)/t19-,21-,22-,26+,33-/m1/s1 |
| InChIKey | YNCFUXRENKYPMV-INZPVISWSA-N |
| XLogP | 4.22 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|