C30H35N5O3 — CID 58559043
5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoic acid (PubChem CID 58559043) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoic acid.
| Compound Name | 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoic acid |
|---|---|
| PubChem CID | 58559043 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoic acid |
| SMILES | Cc1cc(-c2noc(-c3nn(Cc4cccnc4)c4c3CCC(C)(C)C4)n2)cc(C)c1CCCCC(=O)O |
| InChI | InChI=1S/C30H35N5O3/c1-19-14-22(15-20(2)23(19)9-5-6-10-26(36)37)28-32-29(38-34-28)27-24-11-12-30(3,4)16-25(24)35(33-27)18-21-8-7-13-31-17-21/h7-8,13-15,17H,5-6,9-12,16,18H2,1-4H3,(H,36,37) |
| InChIKey | LOSVJYLQNOEWTE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|