C22H23F3N4O — CID 58559103
3-[4-prop-2-enyl-3-(trifluoromethyl)phenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole (PubChem CID 58559103) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 3-[4-prop-2-enyl-3-(trifluoromethyl)phenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-prop-2-enyl-3-(trifluoromethyl)phenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 58559103 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-[4-prop-2-enyl-3-(trifluoromethyl)phenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole |
| SMILES | C=CCc1ccc(-c2noc(-c3nn(C)c4c3CCC(C)(C)C4)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H23F3N4O/c1-5-6-13-7-8-14(11-16(13)22(23,24)25)19-26-20(30-28-19)18-15-9-10-21(2,3)12-17(15)29(4)27-18/h5,7-8,11H,1,6,9-10,12H2,2-4H3 |
| InChIKey | RNFSRGMAIMZTAT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|