C18H22N2O2 — CID 58559111
tert-butyl 4-(4-isocyano-3-methylphenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 58559111) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is tert-butyl 4-(4-isocyano-3-methylphenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-isocyano-3-methylphenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 58559111 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | tert-butyl 4-(4-isocyano-3-methylphenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(C2=CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C18H22N2O2/c1-13-12-15(6-7-16(13)19-5)14-8-10-20(11-9-14)17(21)22-18(2,3)4/h6-8,12H,9-11H2,1-4H3 |
| InChIKey | CJPJJGHVARMBHV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|