About (6Z,9Z)-18-isocyanooctadeca-6,9-diene
(6Z,9Z)-18-isocyanooctadeca-6,9-diene (PubChem CID 58559549) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is (6Z,9Z)-18-isocyanooctadeca-6,9-diene.
Molecular Properties
| Compound Name | (6Z,9Z)-18-isocyanooctadeca-6,9-diene |
| PubChem CID | 58559549 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (6Z,9Z)-18-isocyanooctadeca-6,9-diene |
| SMILES | [C-]#[N+]CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C19H33N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-2/h7-8,10-11H,3-6,9,12-19H2,1H3/b8-7-,11-10- |
| InChIKey | ZNCXIYHFIWWHSM-NQLNTKRDSA-N |
| XLogP | 6.72 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z,9Z)-18-isocyanooctadeca-6,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,9Z)-18-isocyanooctadeca-6,9-diene?
The IUPAC name of (6Z,9Z)-18-isocyanooctadeca-6,9-diene (CID 58559549) is (6Z,9Z)-18-isocyanooctadeca-6,9-diene.
What is the SMILES notation for (6Z,9Z)-18-isocyanooctadeca-6,9-diene?
The canonical SMILES for (6Z,9Z)-18-isocyanooctadeca-6,9-diene is [C-]#[N+]CCCCCCCC/C=C\C/C=C\CCCCC.
What is the InChIKey of (6Z,9Z)-18-isocyanooctadeca-6,9-diene?
The InChIKey is ZNCXIYHFIWWHSM-NQLNTKRDSA-N. The full InChI is InChI=1S/C19H33N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-2/h7-8,10-11H,3-6,9,12-19H2,1H3/b8-7-,11-10-.
What are the key properties of (6Z,9Z)-18-isocyanooctadeca-6,9-diene?
(6Z,9Z)-18-isocyanooctadeca-6,9-diene has a molecular weight of 275.48 g/mol, XLogP of 6.72, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,9Z)-18-isocyanooctadeca-6,9-diene is sourced from PubChem (CID 58559549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).