C46H83NO — CID 58559566
(12Z,15Z)-1-[3-(dimethylamino)cyclopentyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-one (PubChem CID 58559566) has the molecular formula C46H83NO and a molecular weight of 666.18 g/mol. Its IUPAC name is (12Z,15Z)-1-[3-(dimethylamino)cyclopentyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-one.
| Compound Name | (12Z,15Z)-1-[3-(dimethylamino)cyclopentyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-one |
|---|---|
| PubChem CID | 58559566 |
| Molecular Formula | C46H83NO |
| Molecular Weight | 666.18 g/mol |
| Exact Mass | 665.65 |
| IUPAC Name | (12Z,15Z)-1-[3-(dimethylamino)cyclopentyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CC(=O)C1CCC(N(C)C)C1 |
| InChI | InChI=1S/C46H83NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(41-46(48)44-39-40-45(42-44)47(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43-45H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | UIZBBYAZMACVAL-KWXKLSQISA-N |
| XLogP | 14.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.18 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|