C43H77NO2 — CID 58559577
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] (E)-4-(dimethylamino)but-2-enoate (PubChem CID 58559577) has the molecular formula C43H77NO2 and a molecular weight of 640.09 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] (E)-4-(dimethylamino)but-2-enoate.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] (E)-4-(dimethylamino)but-2-enoate |
|---|---|
| PubChem CID | 58559577 |
| Molecular Formula | C43H77NO2 |
| Molecular Weight | 640.09 g/mol |
| Exact Mass | 639.60 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] (E)-4-(dimethylamino)but-2-enoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C43H77NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(46-43(45)40-37-41-44(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,37,40,42H,5-12,17-18,23-36,38-39,41H2,1-4H3/b15-13-,16-14-,21-19-,22-20-,40-37+ |
| InChIKey | XYYNAGBPFFRISW-TXVRRQHZSA-N |
| XLogP | 13.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.09 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|