C47H83NO — CID 58559605
(12Z,15Z,18Z)-1-[2-(dimethylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15,18-trien-1-one (PubChem CID 58559605) has the molecular formula C47H83NO and a molecular weight of 678.19 g/mol. Its IUPAC name is (12Z,15Z,18Z)-1-[2-(dimethylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15,18-trien-1-one.
| Compound Name | (12Z,15Z,18Z)-1-[2-(dimethylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15,18-trien-1-one |
|---|---|
| PubChem CID | 58559605 |
| Molecular Formula | C47H83NO |
| Molecular Weight | 678.19 g/mol |
| Exact Mass | 677.65 |
| IUPAC Name | (12Z,15Z,18Z)-1-[2-(dimethylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15,18-trien-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CC(=O)C1CCCCC1N(C)C |
| InChI | InChI=1S/C47H83NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-44(43-47(49)45-41-37-38-42-46(45)48(3)4)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h7,9,13-16,19-22,44-46H,5-6,8,10-12,17-18,23-43H2,1-4H3/b9-7-,15-13-,16-14-,21-19-,22-20- |
| InChIKey | QAJWVFCFSBVQJM-PLCAWLAJSA-N |
| XLogP | 14.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.19 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|