About [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate
[1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate (PubChem CID 58559999) has the molecular formula C17H27F3O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate |
| PubChem CID | 58559999 |
| Molecular Formula | C17H27F3O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(CCCC(=O)OC(C)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C17H27F3O4/c1-4-12(2)15(22)24-16(9-5-6-10-16)11-7-8-14(21)23-13(3)17(18,19)20/h12-13H,4-11H2,1-3H3 |
| InChIKey | JNVZCTHJELWHBM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate?
The IUPAC name of [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate (CID 58559999) is [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate.
What is the SMILES notation for [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate?
The canonical SMILES for [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate is CCC(C)C(=O)OC1(CCCC(=O)OC(C)C(F)(F)F)CCCC1.
What is the InChIKey of [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate?
The InChIKey is JNVZCTHJELWHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27F3O4/c1-4-12(2)15(22)24-16(9-5-6-10-16)11-7-8-14(21)23-13(3)17(18,19)20/h12-13H,4-11H2,1-3H3.
What are the key properties of [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate?
[1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate has a molecular weight of 352.39 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)butyl]cyclopentyl] 2-methylbutanoate is sourced from PubChem (CID 58559999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).