About dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol
dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol (PubChem CID 58560041) has the molecular formula C17H16Cl2F3NOZr
and a molecular weight of 469.45 g/mol. Its IUPAC name is dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol.
Molecular Properties
| Compound Name | dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol |
| PubChem CID | 58560041 |
| Molecular Formula | C17H16Cl2F3NOZr |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol |
| SMILES | CC(O)(C/C(=N/c1ccccc1)c1ccccc1)C(F)(F)F.Cl[Zr]Cl |
| InChI | InChI=1S/C17H16F3NO.2ClH.Zr/c1-16(22,17(18,19)20)12-15(13-8-4-2-5-9-13)21-14-10-6-3-7-11-14;;;/h2-11,22H,12H2,1H3;2*1H;/q;;;+2/p-2/b21-15-;;; |
| InChIKey | IYHOYAURTOKUDS-GFUICEEBSA-L |
| XLogP | 5.89 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol?
The IUPAC name of dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol (CID 58560041) is dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol.
What is the SMILES notation for dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol?
The canonical SMILES for dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol is CC(O)(C/C(=N/c1ccccc1)c1ccccc1)C(F)(F)F.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol?
The InChIKey is IYHOYAURTOKUDS-GFUICEEBSA-L. The full InChI is InChI=1S/C17H16F3NO.2ClH.Zr/c1-16(22,17(18,19)20)12-15(13-8-4-2-5-9-13)21-14-10-6-3-7-11-14;;;/h2-11,22H,12H2,1H3;2*1H;/q;;;+2/p-2/b21-15-;;;.
What are the key properties of dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol?
dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol has a molecular weight of 469.45 g/mol, XLogP of 5.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;1,1,1-trifluoro-2-methyl-4-phenyl-4-phenyliminobutan-2-ol is sourced from PubChem (CID 58560041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).