C22H29F3O4S — CID 58560619
[(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] trifluoromethanesulfonate (PubChem CID 58560619) has the molecular formula C22H29F3O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is [(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58560619 |
| Molecular Formula | C22H29F3O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] trifluoromethanesulfonate |
| SMILES | CCCCCc1cc2c(c(OS(=O)(=O)C(F)(F)F)c1)[C@@H]1CC(C)=CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C22H29F3O4S/c1-5-6-7-8-15-12-18-20(19(13-15)29-30(26,27)22(23,24)25)16-11-14(2)9-10-17(16)21(3,4)28-18/h9,12-13,16-17H,5-8,10-11H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | MHFUHVLMJZQNLR-IAGOWNOFSA-N |
| XLogP | 6.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|