C20H28O3 — CID 58560661
(3R)-8-[(4R,5R)-5-(4-cyclopropylbutyl)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-ol (PubChem CID 58560661) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3R)-8-[(4R,5R)-5-(4-cyclopropylbutyl)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-ol.
| Compound Name | (3R)-8-[(4R,5R)-5-(4-cyclopropylbutyl)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 58560661 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3R)-8-[(4R,5R)-5-(4-cyclopropylbutyl)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-ol |
| SMILES | C=C[C@@H](O)C#CC#CC[C@H]1OC(C)(C)O[C@@H]1CCCCC1CC1 |
| InChI | InChI=1S/C20H28O3/c1-4-17(21)11-6-5-7-12-18-19(23-20(2,3)22-18)13-9-8-10-16-14-15-16/h4,16-19,21H,1,8-10,12-15H2,2-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | ZWKRPVDXEIJBFF-GUDVDZBRSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|