C22H36O4 — CID 58560663
(4R,5R)-4-heptyl-5-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 58560663) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-5-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-5-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 58560663 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (4R,5R)-4-heptyl-5-[6-(2-methoxypropan-2-yloxy)hexa-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCCC[C@H]1OC(C)(C)O[C@@H]1CC#CC#CCOC(C)(C)OC |
| InChI | InChI=1S/C22H36O4/c1-7-8-9-10-13-16-19-20(26-22(4,5)25-19)17-14-11-12-15-18-24-21(2,3)23-6/h19-20H,7-10,13,16-18H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | OIQZMSOQVYLFQU-WOJBJXKFSA-N |
| XLogP | 4.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|