C19H26O3 — CID 58560670
(3R)-7-[(4R,5R)-2,2-dimethyl-5-[(2-propylcyclopropyl)methyl]-1,3-dioxolan-4-yl]hept-1-en-4,6-diyn-3-ol (PubChem CID 58560670) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (3R)-7-[(4R,5R)-2,2-dimethyl-5-[(2-propylcyclopropyl)methyl]-1,3-dioxolan-4-yl]hept-1-en-4,6-diyn-3-ol.
| Compound Name | (3R)-7-[(4R,5R)-2,2-dimethyl-5-[(2-propylcyclopropyl)methyl]-1,3-dioxolan-4-yl]hept-1-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 58560670 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (3R)-7-[(4R,5R)-2,2-dimethyl-5-[(2-propylcyclopropyl)methyl]-1,3-dioxolan-4-yl]hept-1-en-4,6-diyn-3-ol |
| SMILES | C=C[C@@H](O)C#CC#C[C@H]1OC(C)(C)O[C@@H]1CC1CC1CCC |
| InChI | InChI=1S/C19H26O3/c1-5-9-14-12-15(14)13-18-17(21-19(3,4)22-18)11-8-7-10-16(20)6-2/h6,14-18,20H,2,5,9,12-13H2,1,3-4H3/t14?,15?,16-,17-,18-/m1/s1 |
| InChIKey | RKOZHKXALXXBTE-NHHFINERSA-N |
| XLogP | 2.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|