C22H18N6O2 — CID 58560908
2-[2-[4-(4-methylanilino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 58560908) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[2-[4-(4-methylanilino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(4-methylanilino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58560908 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[2-[4-(4-methylanilino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(Nc2ncnc3c2cnn3CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H18N6O2/c1-14-6-8-15(9-7-14)26-19-18-12-25-28(20(18)24-13-23-19)11-10-27-21(29)16-4-2-3-5-17(16)22(27)30/h2-9,12-13H,10-11H2,1H3,(H,23,24,26) |
| InChIKey | UWPQVHNODIKCTN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|