C23H38N4O2S — CID 58561177
4-[8-(dimethylamino)octyl]-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 58561177) has the molecular formula C23H38N4O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is 4-[8-(dimethylamino)octyl]-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 4-[8-(dimethylamino)octyl]-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58561177 |
| Molecular Formula | C23H38N4O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 4-[8-(dimethylamino)octyl]-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1N(C)S(=O)(=O)c1ccc(CCCCCCCCN(C)C)cc1 |
| InChI | InChI=1S/C23H38N4O2S/c1-19-23(20(2)26(5)24-19)27(6)30(28,29)22-16-14-21(15-17-22)13-11-9-7-8-10-12-18-25(3)4/h14-17H,7-13,18H2,1-6H3 |
| InChIKey | YLYZSKPIJSILNO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|