C21H27Cl2N5O2S — CID 58561222
2,6-dichloro-4-(5-imidazol-1-ylpentyl)-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 58561222) has the molecular formula C21H27Cl2N5O2S and a molecular weight of 484.45 g/mol. Its IUPAC name is 2,6-dichloro-4-(5-imidazol-1-ylpentyl)-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-4-(5-imidazol-1-ylpentyl)-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58561222 |
| Molecular Formula | C21H27Cl2N5O2S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2,6-dichloro-4-(5-imidazol-1-ylpentyl)-N-methyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1N(C)S(=O)(=O)c1c(Cl)cc(CCCCCn2ccnc2)cc1Cl |
| InChI | InChI=1S/C21H27Cl2N5O2S/c1-15-20(16(2)26(3)25-15)27(4)31(29,30)21-18(22)12-17(13-19(21)23)8-6-5-7-10-28-11-9-24-14-28/h9,11-14H,5-8,10H2,1-4H3 |
| InChIKey | VXNRXMGFBZVSJE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|