C20H16F3N5O2 — CID 58561579
4-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]methyl]aniline (PubChem CID 58561579) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 4-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]methyl]aniline.
| Compound Name | 4-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 58561579 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]methyl]aniline |
| SMILES | Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)nn1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C20H16F3N5O2/c1-12-10-17(26-28(12)11-13-2-6-15(24)7-3-13)19-25-18(27-30-19)14-4-8-16(9-5-14)29-20(21,22)23/h2-10H,11,24H2,1H3 |
| InChIKey | PTJBPXBYFVIQSH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|