C23H36N2O3S — CID 58561681
1-(3-methylphenyl)-3-[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]propan-1-one (PubChem CID 58561681) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]propan-1-one.
| Compound Name | 1-(3-methylphenyl)-3-[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 58561681 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-(3-methylphenyl)-3-[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]propan-1-one |
| SMILES | CCCS(=O)(=O)N1CCN(C2(CCC(=O)c3cccc(C)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C23H36N2O3S/c1-3-18-29(27,28)25-16-14-24(15-17-25)23(11-5-4-6-12-23)13-10-22(26)21-9-7-8-20(2)19-21/h7-9,19H,3-6,10-18H2,1-2H3 |
| InChIKey | CPWFBCAKPXIGKX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |