C23H28F6N5O3S+ — CID 58561876
1-[2,4-bis(trifluoromethyl)phenyl]-3-[1-[4-[(1-methyl-1,2,4-triazol-4-ium-4-yl)sulfonyl]piperazin-1-yl]cyclopentyl]propan-1-one (PubChem CID 58561876) has the molecular formula C23H28F6N5O3S+ and a molecular weight of 568.56 g/mol. Its IUPAC name is 1-[2,4-bis(trifluoromethyl)phenyl]-3-[1-[4-[(1-methyl-1,2,4-triazol-4-ium-4-yl)sulfonyl]piperazin-1-yl]cyclopentyl]propan-1-one.
| Compound Name | 1-[2,4-bis(trifluoromethyl)phenyl]-3-[1-[4-[(1-methyl-1,2,4-triazol-4-ium-4-yl)sulfonyl]piperazin-1-yl]cyclopentyl]propan-1-one |
|---|---|
| PubChem CID | 58561876 |
| Molecular Formula | C23H28F6N5O3S+ |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 1-[2,4-bis(trifluoromethyl)phenyl]-3-[1-[4-[(1-methyl-1,2,4-triazol-4-ium-4-yl)sulfonyl]piperazin-1-yl]cyclopentyl]propan-1-one |
| SMILES | Cn1c[n+](S(=O)(=O)N2CCN(C3(CCC(=O)c4ccc(C(F)(F)F)cc4C(F)(F)F)CCCC3)CC2)cn1 |
| InChI | InChI=1S/C23H28F6N5O3S/c1-31-16-34(15-30-31)38(36,37)33-12-10-32(11-13-33)21(7-2-3-8-21)9-6-20(35)18-5-4-17(22(24,25)26)14-19(18)23(27,28)29/h4-5,14-16H,2-3,6-13H2,1H3/q+1 |
| InChIKey | UUANQOKOUHKSHE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|