About 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane
4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane (PubChem CID 58561980) has the molecular formula C14H28O3S
and a molecular weight of 276.44 g/mol. Its IUPAC name is 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane.
Molecular Properties
| Compound Name | 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane |
| PubChem CID | 58561980 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane |
| SMILES | CC1(CS(=O)(=O)C(C)(C)C(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C14H28O3S/c1-12(2,3)13(4,5)18(15,16)11-14(6)7-9-17-10-8-14/h7-11H2,1-6H3 |
| InChIKey | UNBPOGQWUQHAQF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane?
The IUPAC name of 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane (CID 58561980) is 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane.
What is the SMILES notation for 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane?
The canonical SMILES for 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane is CC1(CS(=O)(=O)C(C)(C)C(C)(C)C)CCOCC1.
What is the InChIKey of 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane?
The InChIKey is UNBPOGQWUQHAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3S/c1-12(2,3)13(4,5)18(15,16)11-14(6)7-9-17-10-8-14/h7-11H2,1-6H3.
What are the key properties of 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane?
4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane has a molecular weight of 276.44 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-(2,3,3-trimethylbutan-2-ylsulfonylmethyl)oxane is sourced from PubChem (CID 58561980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).