About (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine
(3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine (PubChem CID 58562000) has the molecular formula C11H22FNO2S
and a molecular weight of 251.37 g/mol. Its IUPAC name is (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine |
| PubChem CID | 58562000 |
| Molecular Formula | C11H22FNO2S |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine |
| SMILES | CC(C)(C)C(C)(C)S(=O)(=O)N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C11H22FNO2S/c1-10(2,3)11(4,5)16(14,15)13-7-6-9(12)8-13/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | LVSLKTSWQJNXFI-SECBINFHSA-N |
| XLogP | 2.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine?
The IUPAC name of (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine (CID 58562000) is (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine.
What is the SMILES notation for (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine?
The canonical SMILES for (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine is CC(C)(C)C(C)(C)S(=O)(=O)N1CC[C@@H](F)C1.
What is the InChIKey of (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine?
The InChIKey is LVSLKTSWQJNXFI-SECBINFHSA-N. The full InChI is InChI=1S/C11H22FNO2S/c1-10(2,3)11(4,5)16(14,15)13-7-6-9(12)8-13/h9H,6-8H2,1-5H3/t9-/m1/s1.
What are the key properties of (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine?
(3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine has a molecular weight of 251.37 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-fluoro-1-(2,3,3-trimethylbutan-2-ylsulfonyl)pyrrolidine is sourced from PubChem (CID 58562000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).