C14H21F3O3 — CID 58562505
4-(1,4-dioxaspiro[4.5]decan-8-yl)-1,1,1-trifluorohexan-2-one (PubChem CID 58562505) has the molecular formula C14H21F3O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.5]decan-8-yl)-1,1,1-trifluorohexan-2-one.
| Compound Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)-1,1,1-trifluorohexan-2-one |
|---|---|
| PubChem CID | 58562505 |
| Molecular Formula | C14H21F3O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)-1,1,1-trifluorohexan-2-one |
| SMILES | CCC(CC(=O)C(F)(F)F)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H21F3O3/c1-2-10(9-12(18)14(15,16)17)11-3-5-13(6-4-11)19-7-8-20-13/h10-11H,2-9H2,1H3 |
| InChIKey | BBTBWQYJNMMYAO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |