C14H19FN2OS — CID 58562953
(5S)-5-(5-amino-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 58562953) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is (5S)-5-(5-amino-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5S)-5-(5-amino-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 58562953 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (5S)-5-(5-amino-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)C[C@@](C)(c2cc(N)ccc2F)NC(=S)CO1 |
| InChI | InChI=1S/C14H19FN2OS/c1-13(2)8-14(3,17-12(19)7-18-13)10-6-9(16)4-5-11(10)15/h4-6H,7-8,16H2,1-3H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | RPIWKNNCFAXPGK-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|