About tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate
tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate (PubChem CID 58562995) has the molecular formula C19H28FNO5S
and a molecular weight of 401.50 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate |
| PubChem CID | 58562995 |
| Molecular Formula | C19H28FNO5S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@](C)(C[S@](=O)C(C)(C)C)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C19H28FNO5S/c1-17(2,3)26-16(22)11-19(7,12-27(25)18(4,5)6)14-10-13(21(23)24)8-9-15(14)20/h8-10H,11-12H2,1-7H3/t19-,27+/m1/s1 |
| InChIKey | NFNUZYPZDPCYGR-WINIVTDRSA-N |
| XLogP | 4.27 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate?
The IUPAC name of tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate (CID 58562995) is tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate.
What is the SMILES notation for tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate?
The canonical SMILES for tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate is CC(C)(C)OC(=O)C[C@](C)(C[S@](=O)C(C)(C)C)c1cc([N+](=O)[O-])ccc1F.
What is the InChIKey of tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate?
The InChIKey is NFNUZYPZDPCYGR-WINIVTDRSA-N. The full InChI is InChI=1S/C19H28FNO5S/c1-17(2,3)26-16(22)11-19(7,12-27(25)18(4,5)6)14-10-13(21(23)24)8-9-15(14)20/h8-10H,11-12H2,1-7H3/t19-,27+/m1/s1.
What are the key properties of tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate?
tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate has a molecular weight of 401.50 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-4-[(S)-tert-butylsulfinyl]-3-(2-fluoro-5-nitrophenyl)-3-methylbutanoate is sourced from PubChem (CID 58562995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).