C14H17BrFNO2 — CID 58563092
(5S)-5-(5-bromo-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepan-3-one (PubChem CID 58563092) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is (5S)-5-(5-bromo-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepan-3-one.
| Compound Name | (5S)-5-(5-bromo-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 58563092 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (5S)-5-(5-bromo-2-fluorophenyl)-5,7,7-trimethyl-1,4-oxazepan-3-one |
| SMILES | CC1(C)C[C@@](C)(c2cc(Br)ccc2F)NC(=O)CO1 |
| InChI | InChI=1S/C14H17BrFNO2/c1-13(2)8-14(3,17-12(18)7-19-13)10-6-9(15)4-5-11(10)16/h4-6H,7-8H2,1-3H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | QGHOABGANXWQBP-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |